| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | methanetrisulphonic acid Basic information |
| Product Name: | methanetrisulphonic acid | | Synonyms: | methanetrisulphonic acid;Methanetrisulfonic acid;Einecs 259-097-5;Methane Trisulfonic Acid 50%;Methanetrisulfonic acid 50% aqu solution;Methanetrisulfonic acid solution | | CAS: | 54322-33-7 | | MF: | CH4O9S3 | | MW: | 256.23 | | EINECS: | 259-097-5 | | Product Categories: | | | Mol File: | 54322-33-7.mol |  |
| | methanetrisulphonic acid Chemical Properties |
| Boiling point | 509.52℃[at 101 325 Pa] | | density | 2.536±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | pka | -3.05±0.50(Predicted) | | Water Solubility | 836mg/L at 25℃ | | InChI | InChI=1S/CH4O9S3/c2-11(3,4)1(12(5,6)7)13(8,9)10/h1H,(H,2,3,4)(H,5,6,7)(H,8,9,10) | | InChIKey | NARPMWPOFWHFDX-UHFFFAOYSA-N | | SMILES | C(S(O)(=O)=O)(S(O)(=O)=O)S(O)(=O)=O | | LogP | -2.56 |
| | methanetrisulphonic acid Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | methanetrisulphonic acid Preparation Products And Raw materials |
|