|
|
| | 1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]ethan-1-one hydrochloride Basic information |
| Product Name: | 1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]ethan-1-one hydrochloride | | Synonyms: | 1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]ethan-1-one hydrochloride;4-Amino-3,5-dichlor-alpha-tert.-butylamino-acetophenon;1-(4-Amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]ethanone/hydrochloride,(1:x);4-Amino-3,5-dichlor-alpha-tert.-butylamino-acetophenon HCl;4-Amino-3,5-dichloro-alpha-tert-butylaminoacetophenone;Clenbuterol Related Compound B (10 mg) (1-(4-amino-3,5-dichlorophenyl)-2-tert-butylaminoethanone hydrochloride);Ethanone, 1-(4-aMino-3,5-dichlorophenyl)-2-[(1,1-diMethylethyl)aMino]-, hydrochloride (1:);Keto Clenbuterol Hydrochloride | | CAS: | 37148-49-5 | | MF: | C12H17Cl3N2O | | MW: | 311.63518 | | EINECS: | 253-369-7 | | Product Categories: | | | Mol File: | 37148-49-5.mol | ![1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]ethan-1-one hydrochloride Structure](CAS/GIF/37148-49-5.gif) |
| | 1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]ethan-1-one hydrochloride Chemical Properties |
| Melting point | >178oC (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Beige | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C12H16Cl2N2O.ClH/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7;/h4-5,16H,6,15H2,1-3H3;1H | | InChIKey | VCMBTLCRANMPCO-UHFFFAOYSA-N | | SMILES | [Cl-].Clc1c(c(cc(c1)C(=O)CNC(C)(C)C)Cl)N.[H+] |
| WGK Germany | WGK 3 | | HS Code | 2923900100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]ethan-1-one hydrochloride Usage And Synthesis |
| Uses | Keto Clenbuterol Hydrochloride is an impurity in the synthesis of Clenbuterol (C569998) a substituted phenylethanolamine with β2 sympathomimetic activity. Bronchodilator. A β-Agonist which can be used as a growth promoter in farm animals. |
| | 1-(4-amino-3,5-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]ethan-1-one hydrochloride Preparation Products And Raw materials |
|