Uridine 5'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester manufacturers
|
| | Uridine 5'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester Basic information |
| Product Name: | Uridine 5'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester | | Synonyms: | Uridine 5'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester;Uridine 5'-pyrophosphate, D-glucosyl ester;Uridine diphosphoglucose;[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-[hydroxy-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-phosphoryl]oxy-phosphinic acid;Uridine diphosphate glucose;Uridine-5''-diphospho-D-glucose;UDP-D-glucose;Uridine 5'-(trihydrogen diphosphate mono-β-D-glucopyranosyl | | CAS: | 133-89-1 | | MF: | C15H24N2O17P2 | | MW: | 566.3 | | EINECS: | 2051214 | | Product Categories: | | | Mol File: | 133-89-1.mol |  |
| | Uridine 5'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester Chemical Properties |
| storage temp. | Store at -20°C, protect from light, stored under nitrogen | | solubility | Easily soluble (water), soluble (methanol), insoluble ((CH3)2CO, (C2H5)2O) | | form | Solid | | density | 1.97±0.1 g/cm3(Predicted) | | pKa | 1.10±0.50(Predicted) | | color | White to off-white | | Water Solubility | Water : ≥ 50 mg/mL | | InChIKey | HSCJRCZFDFQWRP-JZMIEXBBSA-N | | SMILES | O[C@@H]1[C@@H]([C@H](O[C@H]1N1C=CC(NC1=O)=O)COP(O)(=O)OP(O)(=O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
| | Uridine 5'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester Usage And Synthesis |
| Description | An intermediate in the phase II reaction
that results in the formation of glucose conjugates of xenobiotics which contain substituents such as hydroxyl, amino or
sulfhydryl groups, the O-, N-, and S-glucosides, respectively.
UDPG is formed from uridine triphosphate and glucose-1-
phosphate in a reaction catalyzed by the enzyme UDPG pyro_x0002_phosphorylase. Glucoside formation is common in insects and
plants, whereas animals other than insects utilize uridine
diphosphate glucuronic acid to form glucuronides. | | Uses | Uridine diphosphate glucose (Standard) is the analytical standard of Uridine diphosphate glucose. This product is intended for research and analytical applications. Uridine diphosphate glucose is the precursor of glucose-containing oligosaccharides, polysaccharides, glycoproteins, and glycolipids in animal tissues and in some microorganisms. Uridine diphosphate glucose is an agonist of the P2Y14 receptor, a neuroimmune system GPCR. | | Definition | ChEBI: UDP-alpha-D-glucose is the alpha-anomer of UDP-alpha-D-glucose. It is used in nucleotide sugars metabolism. It has a role as a fundamental metabolite. It is a conjugate acid of an UDP-alpha-D-glucose(2-). |
| | Uridine 5'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester Preparation Products And Raw materials |
|