pentaerythritol octahydrogen tetraphosphate manufacturers
|
| | pentaerythritol octahydrogen tetraphosphate Basic information | | Uses |
| Product Name: | pentaerythritol octahydrogen tetraphosphate | | Synonyms: | pentaerythritol octahydrogen tetraphosphate;Pentaerythritol tetrakis(dihydrogen phosphate);1,3-Propanediol, 2,2-bis((phosphonooxy)methyl)-, 1,3-bis(dihydrogen phosphate);1,3-Propanediol, 2,2-bis((phosphonooxy)methyl)-, bis(dihydrogen phosphate);Einecs 231-181-6;2,2-Bis[(phosphonooxy)methyl]-1,3-propanediol 1,3-bis(dihydrogen phosphate);pentaerythritol octahydrogen tetraphosphate ISO 9001：2015 REACH;3-phosphonooxy-2,2-bis(phosphonooxymethyl)propyl]dihydrogenphosphate | | CAS: | 7440-78-0 | | MF: | C5H16O16P4 | | MW: | 456.07 | | EINECS: | 231-181-6 | | Product Categories: | | | Mol File: | 7440-78-0.mol |  |
| | pentaerythritol octahydrogen tetraphosphate Chemical Properties |
| density | 2.139 | | InChI | InChI=1S/C5H16O16P4/c6-22(7,8)18-1-5(2-19-23(9,10)11,3-20-24(12,13)14)4-21-25(15,16)17/h1-4H2,(H2,6,7,8)(H2,9,10,11)(H2,12,13,14)(H2,15,16,17) | | InChIKey | NXWHTQVVOSZLDP-UHFFFAOYSA-N | | SMILES | C(OP(O)(O)=O)C(COP(O)(O)=O)(COP(O)(O)=O)COP(O)(O)=O | | EPA Substance Registry System | 1,3-Propanediol, 2,2-bis[(phosphonooxy)methyl]-, bis(dihydrogen phosphate) (7440-78-0) |
| | pentaerythritol octahydrogen tetraphosphate Usage And Synthesis |
| Uses | Pentaerythritol phosphate is an intermediate in the manufacture of a series of phosphorus-containing or phosphorus-halogen-containing flame retardants. It can also be used in flame-retardant plastic adhesives and coatings, or as a component of mixed intumescent flame retardants. |
| | pentaerythritol octahydrogen tetraphosphate Preparation Products And Raw materials |
|