| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:3,3,3-Tris(4-chlorophenyl)propionitrile
CAS:2172-51-2
Purity:99% Package:100G Remarks:275204-100G
|
| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:3,3,3-Tris(4-chlorophenyl)propionitrile 99%
CAS:2172-51-2
Purity:99% Package:100g Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:3,3,3-Tris(4-chlorophenyl)propionitrile
CAS:2172-51-2
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
CAS:2172-51-2
|
|
| | 2,2,3-tris(4-chlorophenyl)propiononitrile Basic information |
| Product Name: | 2,2,3-tris(4-chlorophenyl)propiononitrile | | Synonyms: | 3,3,3-TRIS(4-CHLOROPHENYL)PROPIONITRILE, 99%;2,2,3-tris(4-chlorophenyl)propiononitrile;4-Chloro-β,β-bis(4-chlorophenyl)benzenepropiononitrile;Benzenepropanenitrile, 4-chloro-β,β-bis(4-chlorophenyl)-;3,3,3-Tris(4-chlorophenyl)propionitrile 99%;3,3,3-Tris(4-chlorophenyl)propanenitrile | | CAS: | 2172-51-2 | | MF: | C21H14Cl3N | | MW: | 386.7 | | EINECS: | 218-526-6 | | Product Categories: | | | Mol File: | 2172-51-2.mol |  |
| | 2,2,3-tris(4-chlorophenyl)propiononitrile Chemical Properties |
| Melting point | 175-177 °C (lit.) | | Boiling point | 532.1±45.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C21H14Cl3N/c22-18-7-1-15(2-8-18)21(13-14-25,16-3-9-19(23)10-4-16)17-5-11-20(24)12-6-17/h1-12H,13H2 | | InChIKey | SGXWKWVVMYKJNN-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)C(CC#N)(c2ccc(Cl)cc2)c3ccc(Cl)cc3 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | 2,2,3-tris(4-chlorophenyl)propiononitrile Usage And Synthesis |
| | 2,2,3-tris(4-chlorophenyl)propiononitrile Preparation Products And Raw materials |
|