BHQ-1 amine manufacturers
- BHQ-1 amine
-
-
2025-06-07
- CAS:1308657-79-5
- Min. Order: 25mg
- Purity: >95.00%
- Supply Ability: 25mg
|
| | BHQ-1 amine Basic information |
| Product Name: | BHQ-1 amine | | Synonyms: | BHQ-1 amine;BHQ1 NH2;BHQ-1 NH2;1,3-Propanediamine, N1-[4-[2-[2-methoxy-5-methyl-4-[2-(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]phenyl]-N1-methyl- | | CAS: | 1308657-79-5 | | MF: | C25H29N7O3 | | MW: | 475.54 | | EINECS: | | | Product Categories: | | | Mol File: | 1308657-79-5.mol |  |
| | BHQ-1 amine Chemical Properties |
| Boiling point | 673.7±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | pka | 9.93±0.10(Predicted) | | InChI | InChI=1S/C25H29N7O3/c1-17-6-11-21(24(14-17)32(33)34)28-29-22-16-25(35-4)23(15-18(22)2)30-27-19-7-9-20(10-8-19)31(3)13-5-12-26/h6-11,14-16H,5,12-13,26H2,1-4H3 | | InChIKey | WNHATIZJCRCMEU-UHFFFAOYSA-N | | SMILES | C(N(C1=CC=C(N=NC2=CC(C)=C(N=NC3=CC=C(C)C=C3[N+]([O-])=O)C=C2OC)C=C1)C)CCN |
| | BHQ-1 amine Usage And Synthesis |
| | BHQ-1 amine Preparation Products And Raw materials |
|