|
|
| | 3-Amino-5-bromo-2-fluoropyridine Basic information |
| | 3-Amino-5-bromo-2-fluoropyridine Chemical Properties |
| Melting point | 75-80℃ | | Boiling point | 278.2±35.0 °C(Predicted) | | density | 1.813±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 0.11±0.10(Predicted) | | color | Light yellow | | InChI | InChI=1S/C5H4BrFN2/c6-3-1-4(8)5(7)9-2-3/h1-2H,8H2 | | InChIKey | CLYOMCMDBNNGSM-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(Br)C=C1N |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Amino-5-bromo-2-fluoropyridine Usage And Synthesis |
| Chemical Properties | yellow solid |
| | 3-Amino-5-bromo-2-fluoropyridine Preparation Products And Raw materials |
|