|
|
| | 2-Chloro-3-fluorobromobenzene Basic information |
| | 2-Chloro-3-fluorobromobenzene Chemical Properties |
| Melting point | 29 °C | | Boiling point | 205.7±20.0 °C(Predicted) | | density | 1.719±0.06 g/cm3(Predicted) | | Fp | 29 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Almost white or Almost colorless | | InChI | InChI=1S/C6H3BrClF/c7-4-2-1-3-5(9)6(4)8/h1-3H | | InChIKey | GTIWFNAUYPVPAT-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(F)=C1Cl |
| Hazard Codes | Xi,Xn | | HazardClass | IRRITANT | | HS Code | 2903998090 |
| | 2-Chloro-3-fluorobromobenzene Usage And Synthesis |
| Uses | 2-Chloro-3-fluorobromobenzene is an organic compound mainly used as an intermediate in drug synthesis. |
| | 2-Chloro-3-fluorobromobenzene Preparation Products And Raw materials |
|