| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2,5-Bis[2-(N,N-diethylamino)-ethoxy]-1,4-dibromobenzene CAS:233753-19-0 Purity:2,5-Bis[2-(N,N-diethylamino)-ethoxy]-1,4-dibromobenzene Package:500MG Remarks:669040-500MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:2,5-Bis[2-(N,N-diethylamino)-ethoxy]-1,4-dibromobenzene CAS:233753-19-0 Purity:NULL Package:500mg Remarks:NULL
|
| Company Name: |
Jilin Chinese Academy of Sciences-yanshen Technology
|
| Tel: |
18143011203 |
| Email: |
ET-market@chemextension.com |
| Products Intro: |
Product Name:2,5-bis[3-(N,N-diethylamino)-1-oxapropyl]-1,4-dibromobenzene CAS:233753-19-0 Purity:95%+ Package:1g;5g;10g;25g;50g;100g;
|
|
| | 2,5-BIS(3-(N,N-DIETHYLAMINO)-1-OXAPROPYL Basic information |
| Product Name: | 2,5-BIS(3-(N,N-DIETHYLAMINO)-1-OXAPROPYL | | Synonyms: | 2,5-BIS(3-(N,N-DIETHYLAMINO)-1-OXAPROPYL;Ethanamine, 2,2'-[(2,5-dibromo-1,4-phenylene)bis(oxy)]bis[N,N-diethyl-;2,5-Bis[2-(N,N-diethylamino)-ethoxy]-1,4-dibromobenzene | | CAS: | 233753-19-0 | | MF: | C18H30Br2N2O2 | | MW: | 466.25 | | EINECS: | | | Product Categories: | | | Mol File: | 233753-19-0.mol |  |
| | 2,5-BIS(3-(N,N-DIETHYLAMINO)-1-OXAPROPYL Chemical Properties |
| Melting point | 58-63 °C | | form | solid | | InChI | 1S/C14H22Br2N2O2/c1-17(2)5-7-19-13-9-12(16)14(10-11(13)15)20-8-6-18(3)4/h9-10H,5-8H2,1-4H3 | | InChIKey | ROMKKPMBKLIRCX-UHFFFAOYSA-N | | SMILES | CN(C)CCOc1cc(Br)c(OCCN(C)C)cc1Br |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,5-BIS(3-(N,N-DIETHYLAMINO)-1-OXAPROPYL Usage And Synthesis |
| | 2,5-BIS(3-(N,N-DIETHYLAMINO)-1-OXAPROPYL Preparation Products And Raw materials |
|