| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,2'-((1S,2S)-1,2-Cyclohexanediylbis((e& Basic information |
| Product Name: | 2,2'-((1S,2S)-1,2-Cyclohexanediylbis((e& | | Synonyms: | 2,2'-[(1s,2s)-1,2-cyclohexanediylbis[(e)-(nitrilomethylidyne)]]bis[4-(tert-butyl)-6-(4-piperidinylmethyl)phenol];n,n'-bis[(e)-5-(tert-butyl)-2-hydroxy-3-4-piperidinylmethyl)benzylidene]-[(1s,2s)-1,2-cyclohexanediamine];2,2′-[(1S,2S)-1,2-Cyclohexanediylbis[(E)-(nitriloMethylidyne)]]bis[4-(tert-butyl)-6-(1-piperidinylMethyl)phenol];Phenol, 2,2'-[(1S,2S)-1,2-cyclohexanediylbis[(E)-nitrilomethylidyne]]bis[4-(1,1-dimethylethyl)-6-(1-piperidinylmethyl)-;6,6'-((1E,1'E)-((1S,2S)-Cyclohexane-1,2-diylbis(azanylylidene))bis(methanylylidene))bis(4-(tert-butyl)-2-(piperidin-1-ylmethyl)phenol);2,2′-[(1S,2S)-1,2-Cyclohexanediylbis[(E)-(nitrilomethylidyne)]]bis[4-(tert-butyl)-6-(1-piperidinylmethyl)phenol];2,2'-((1S,2S)-1,2-Cyclohexanediylbis((e& | | CAS: | 478282-27-8 | | MF: | C40H60N4O2 | | MW: | 628.93 | | EINECS: | | | Product Categories: | | | Mol File: | 478282-27-8.mol |  |
| | 2,2'-((1S,2S)-1,2-Cyclohexanediylbis((e& Chemical Properties |
| Melting point | 72-81 °C | | Boiling point | 718.222±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.116±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 8.423±0.50(predicted) | | form | solid | | InChIKey | QWZFCHMBYWXSLV-HKPCBFNZSA-N | | SMILES | CC(C)(C)c1cc(CN2CCCCC2)c(O)c(\C=N\[C@H]3CCCC[C@@H]3\N=C\c4cc(cc(CN5CCCCC5)c4O)C(C)(C)C)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2'-((1S,2S)-1,2-Cyclohexanediylbis((e& Usage And Synthesis |
| Uses | 2,2′-[(1S,2S)-1,2-Cyclohexanediylbis[(E)-(nitrilomethylidyne)]]bis[4-(tert-butyl)-6-(1-piperidinylmethyl)phenol] can be used:
- In the synthesis of chiral Ru(II) salen complexes, which are employed in the binding studies with calf thymus DNA.
- To prepare its titanium metal complexes, which are used as catalysts in the addition of organozinc compounds to α-aldiminoesters and α-ketoesters.
|
| | 2,2'-((1S,2S)-1,2-Cyclohexanediylbis((e& Preparation Products And Raw materials |
|