| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | (1,3-Bis(2,4,6-trimethylphenyl)-2-imida& Basic information |
| Product Name: | (1,3-Bis(2,4,6-trimethylphenyl)-2-imida& | | Synonyms: | RutheniuM,[1,3-bis(2,4,6-triMethylphenyl)-2-iMidazolidinylidene]dichloro(3-Methyl-2-buten-1-ylidene)(tricyclohexylphosphine)-,(SP-5-41)-;Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(3-methyl-2-buten-1-ylidene)(tricyclohexylphosphine)-;Dichloro[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene](3-methyl-2-butenylidene) (tricyclohexylphosphine)ruthenium(II);[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-(3-methylbut-2-enylidene)ruthenium,tricyclohexylphosphane;Grubbs Catalyst C827;Grubbs Catalyst(TM) C827;Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(3-methyl-2-buten-2-ylidene)(tricyclohexylphosphine)-;RutheniuM,[1,3-bis(2,4,6-triMethylphenyl)-2-iMidazolidinylidene]dichloro(3-Methyl-2-buten-1-ylidene)(tricyclohexylphosphine)-,(SP-5Chemicalbook-41)- | | CAS: | 253688-91-4 | | MF: | C44H67Cl2N2PRu | | MW: | 826.96 | | EINECS: | | | Product Categories: | | | Mol File: | 253688-91-4.mol |  |
| | (1,3-Bis(2,4,6-trimethylphenyl)-2-imida& Chemical Properties |
| storage temp. | 2-8°C | | InChIKey | LCOFYVWULBZOTA-UHFFFAOYSA-L | | SMILES | C1CCC(CC1)P(C2CCCCC2)C3CCCCC3.C\C(C)=C/C=[Ru](Cl)(Cl)=C4N(CCN4c5c(C)cc(C)cc5C)c6c(C)cc(C)cc6C |
| Hazard Codes | F | | Risk Statements | 11 | | RIDADR | UN1325 - class 4.1 - PG 2 - Flammable solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 2 |
| | (1,3-Bis(2,4,6-trimethylphenyl)-2-imida& Usage And Synthesis |
| Uses | A general purpose olefin metathesis catalyst similar in reactivity to Grubbs Catalyst 2nd Generation. | | reaction suitability | core: ruthenium
reagent type: catalyst
reaction type: Olefin Metathesis |
| | (1,3-Bis(2,4,6-trimethylphenyl)-2-imida& Preparation Products And Raw materials |
|