| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2-Amino-5-phenyl-1,3,4-thiadiazole sulfa te, 97% Basic information |
| | 2-Amino-5-phenyl-1,3,4-thiadiazole sulfa te, 97% Chemical Properties |
| Melting point | 200 °C (dec.) (lit.) | | InChI | 1S/C8H7N3S.H2O4S/c9-8-11-10-7(12-8)6-4-2-1-3-5-6;1-5(2,3)4/h1-5H,(H2,9,11);(H2,1,2,3,4) | | InChIKey | ANBJJAROENDFHC-UHFFFAOYSA-N | | SMILES | OS(O)(=O)=O.Nc1nnc(s1)-c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Amino-5-phenyl-1,3,4-thiadiazole sulfa te, 97% Usage And Synthesis |
| Uses | 2-Amino-5-phenyl-1,3,4-thiadiazole sulfate salt is a thiadiazole derivative useful in medicinal chemistry. | | General Description | 2-Amino-5-phenyl-1,3,4-thiadiazole sulfate salt is a thiadiazole derivative useful in medicinal chemistry. |
| | 2-Amino-5-phenyl-1,3,4-thiadiazole sulfa te, 97% Preparation Products And Raw materials |
|