|
|
| | Lipoic Acid Impurity 46 Basic information |
| Product Name: | Lipoic Acid Impurity 46 | | Synonyms: | Lipoic Acid Impurity 73;Thioctic Acid Impurity 46;Thioctic Acid Impurity 34;Lipoic Acid Impurity;1,2,3-Trithiane-4-pentanoic acid, ethyl ester;Ethyl 5-(1,2,3-trithian-4-yl)pentanoate;Lipoic Acid Impurity 46;Lipoic Acid Impurity 34 | | CAS: | 2635383-46-7 | | MF: | C10H18O2S3 | | MW: | 266.44 | | EINECS: | | | Product Categories: | | | Mol File: | 2635383-46-7.mol |  |
| | Lipoic Acid Impurity 46 Chemical Properties |
| Boiling point | 368.4±34.0 °C(Predicted) | | density | 1.166±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H18O2S3/c1-2-12-10(11)6-4-3-5-9-7-8-13-15-14-9/h9H,2-8H2,1H3 | | InChIKey | DYACYMSYDPVOMT-UHFFFAOYSA-N | | SMILES | S1CCC(CCCCC(OCC)=O)SS1 |
| | Lipoic Acid Impurity 46 Usage And Synthesis |
| | Lipoic Acid Impurity 46 Preparation Products And Raw materials |
|