|
|
| | Propanedioic acid, 2-propyl-, 1-ethyl 3-methyl ester Basic information |
| | Propanedioic acid, 2-propyl-, 1-ethyl 3-methyl ester Chemical Properties |
| Boiling point | 219.6±8.0 °C(Predicted) | | density | 1.020±0.06 g/cm3(Predicted) | | pka | 13.30±0.46(Predicted) | | InChI | InChI=1S/C9H16O4/c1-4-6-7(8(10)12-3)9(11)13-5-2/h7H,4-6H2,1-3H3 | | InChIKey | MJDNTHAXLBHFFZ-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(CCC)C(OC)=O |
| | Propanedioic acid, 2-propyl-, 1-ethyl 3-methyl ester Usage And Synthesis |
| | Propanedioic acid, 2-propyl-, 1-ethyl 3-methyl ester Preparation Products And Raw materials |
|