|
|
| | Ethanol, 2-[methyl[[4-[4-(1-methylethoxy)phenyl]-1H-pyrrol-3-yl]methyl]amino]- Basic information |
| | Ethanol, 2-[methyl[[4-[4-(1-methylethoxy)phenyl]-1H-pyrrol-3-yl]methyl]amino]- Chemical Properties |
| Boiling point | 465.9±45.0 °C(Predicted) | | density | 1.104±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | pka | 14.74±0.10(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C17H24N2O2/c1-13(2)21-16-6-4-14(5-7-16)17-11-18-10-15(17)12-19(3)8-9-20/h4-7,10-11,13,18,20H,8-9,12H2,1-3H3 | | InChIKey | GNAKYUUZAXUXKB-UHFFFAOYSA-N | | SMILES | CN(CCO)CC1=CNC=C1C2=CC=C(OC(C)C)C=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ethanol, 2-[methyl[[4-[4-(1-methylethoxy)phenyl]-1H-pyrrol-3-yl]methyl]amino]- Usage And Synthesis |
| Biological Activity | MS094 i an inactive control probe for PRMT inhibitor MS023. MS023 is a potent and selective chemical probe for Type I protein arginine methyltransferases (PRMTs) 1,3,4,6,and 8, which are responsible for asymmetric dimethylation of arginine residues. MS023 is active in cells. |
| | Ethanol, 2-[methyl[[4-[4-(1-methylethoxy)phenyl]-1H-pyrrol-3-yl]methyl]amino]- Preparation Products And Raw materials |
|