- Acetagastrodin
-
- $30.00 / 10mg
-
2026-03-13
- CAS:64291-41-4
- Min. Order:
- Purity: 97.09%
- Supply Ability: 10g
- Acegastrodine
-
- $0.00 / 20mg
-
2023-02-24
- CAS:64291-41-4
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | ACETAGASTRODINE Basic information |
| Product Name: | ACETAGASTRODINE | | Synonyms: | ACETAGASTRODINE;Acegastrodine;4-(Hydroxymethyl)phenyl β-D-glucopyranoside 2,3,4,6-tetraacetate;2,3,4,6-Tetra-O-acetyl-4-(hydroxymethyl)phenyl-b-D-glucopyranoside;[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(hydroxymethyl)phenoxy]oxan- 2-yl]methyl acetate;(2R,3R,4S,5R,6S)-2-(AcetoxyMethyl)-6-(4-(hydroxyMethyl)phenoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate;b-D-Glucopyranoside,4-(hydroxymethyl)phenyl, 2,3,4,6-tetraacetate;β-D-Glucopyranoside, 4-(hydroxymethyl)phenyl, 2,3,4,6-tetraacetate | | CAS: | 64291-41-4 | | MF: | C21H26O11 | | MW: | 454.42 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 64291-41-4.mol |  |
| | ACETAGASTRODINE Chemical Properties |
| Melting point | 170-171 °C(Solv: ethanol (64-17-5)) | | Boiling point | 551.4±50.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.42±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | HGUDVDQXCUHOED-YMQHIKHWSA-N | | SMILES | O(C1=CC=C(CO)C=C1)[C@@H]1O[C@H](COC(=O)C)[C@@H](OC(=O)C)[C@H](OC(=O)C)[C@H]1OC(=O)C |
| | ACETAGASTRODINE Usage And Synthesis |
| Uses | Acetagastrodin (compound 4) is an intermediate for the synthesis of DBPG (an antioxidant from Origanum vulgare)[1]. | | References | [1] Li YW, et, al. First and efficient synthesis of 4-(3,4-dihydroxybenzoyl-oxymethyl)-phenyl-O-β-D-glucopyranoside, an antioxidant from Origanum vulgare. Journal of the Serbian Chemical Society. 2015 Jan; 81(00):74-74. |
| | ACETAGASTRODINE Preparation Products And Raw materials |
| Raw materials | 2,3,4,6-TETRA-O-ACETYL-BETA-D-GLUCOPYRANOSE-->2,3,4,6-TETRA-O-ACETYL-BETA-D-GLUCOPYRANOSYL BROMIDE-->(2R,3R,4S,5R,6S)-2-(acetoxymethyl)-6-(p-tolyloxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate-->2,3,4,6-Tetra-O-acetyl-alpha-D-glucopyranosyl bromide-->β-D-Glucose pentaacetate-->β-D-Glucose-->4-Hydroxybenzyl alcohol-->p-Cresol-->4-Hydroxybenzaldehyde-->Acetic acid |
|