|
|
| | Pravastatin 1,1,3,3-tetramethyl butylamine Basic information |
| Product Name: | Pravastatin 1,1,3,3-tetramethyl butylamine | | Synonyms: | [1S-[1a(S*,dS*),2a,6a,8(R*),8aa]]-1,2,6,7,8,8a-Hexahydro-,d,6-trihydroxy-2-methyl-8-(2-methyl-1-oxobutoxy)-1-naphthaleneheptanoate 2,4,4-Trimethyl-2-pentanamine;Pravastatin 1,1,3,3-Tetramethylbutylamine (200 mg);[1S-[1α(βS*,δS*),2α,6α,8β(R*),8aα]]-1,2,6,7,8,8a-Hexahydro-β,δ,6-trihydroxy-2-Methyl-8-(2-Methyl-1-oxobutoxy)-1-naphthaleneheptanoate;Pravastatin 1,1,3,3-TetraMethylbutylaMine Salt;Pravastatin TMBA Salt;Pravastatin Sodium Impurity Ⅰ:6-Epravastatin;Pravastatin 1,1,3,3-Tetramethylbutylamin;Pravastatin 1,1,3,3-TetramethylbutylamineQ: What is
Pravastatin 1,1,3,3-Tetramethylbutylamine Q: What is the CAS Number of
Pravastatin 1,1,3,3-Tetramethylbutylamine Q: What is the storage condition of
Pravastatin 1,1,3,3-Tetramethylbutylamine Q: What are the applications of
Pravastatin 1,1,3,3-Tetramethylbutylamine | | CAS: | 151006-14-3 | | MF: | C31H55NO7 | | MW: | 553.77 | | EINECS: | | | Product Categories: | Chiral Reagents;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 151006-14-3.mol |  |
| | Pravastatin 1,1,3,3-tetramethyl butylamine Chemical Properties |
| Melting point | 51-57°C | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | solid | | color | White to Light Beige | | Major Application | pharmaceutical (small molecule) | | InChIKey | RKFLVBHCVKWNON-IYNICTALSA-N | | SMILES | NC(CC(C)(C)C)(C)C.O([C@@H]1[C@@H]2[C@H]([C@H](C=CC2=C[C@H](C1)O)C)CC[C@@H](O)C[C@@H](O)CC(=O)O)C(=O)[C@H](CC)C |
| WGK Germany | WGK 3 | | HS Code | 2918195000 | | Storage Class | 11 - Combustible Solids |
| | Pravastatin 1,1,3,3-tetramethyl butylamine Usage And Synthesis |
| Uses | A new salt of HMG-CoA reductase inhibitor. |
| | Pravastatin 1,1,3,3-tetramethyl butylamine Preparation Products And Raw materials |
|