|
|
| | (2S,5R)-2-Ethyl-5-methyl-N-Boc-piperazine Basic information |
| Product Name: | (2S,5R)-2-Ethyl-5-methyl-N-Boc-piperazine | | Synonyms: | (2S,5R)-tert-butyl 2-ethyl-5-Methylpiperazine-1-carboxylate;(2S,5R)-2-Ethyl-5-methyl-1-piperazinecarboxylic acid 1,1-dimethylethyl ester;1-Boc-2(S)-ethyl-5(R)-methylpiperazine acetic acid salt;(2S,5R)-Tert-Butyl 5-Ethyl-2-Methylpiperazine-1;tert-butyl (2S,5R)-2-ethyl-5-methylpiperazine-1-carboxylate;(2S,5R)-tert-Butyl 5-ethyl-2-methylpiperazine-1-carboxylate;1-Piperazinecarboxylic acid, 2-ethyl-5-methyl-, 1,1-dimethylethyl ester, (2S,5R)-;(2S,5R)-1-Boc-5-ethyl-2-methylpiperazine | | CAS: | 906559-60-2 | | MF: | C12H24N2O2 | | MW: | 228.33 | | EINECS: | | | Product Categories: | Piperazines | | Mol File: | 906559-60-2.mol |  |
| | (2S,5R)-2-Ethyl-5-methyl-N-Boc-piperazine Chemical Properties |
| Boiling point | 297.4±15.0 °C(Predicted) | | density | 0.958±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 8.55±0.60(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H24N2O2/c1-6-10-7-13-9(2)8-14(10)11(15)16-12(3,4)5/h9-10,13H,6-8H2,1-5H3/t9-,10+/m1/s1 | | InChIKey | PDQANZVZHPLKDA-ZJUUUORDSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C[C@@H](C)NC[C@@H]1CC |
| | (2S,5R)-2-Ethyl-5-methyl-N-Boc-piperazine Usage And Synthesis |
| | (2S,5R)-2-Ethyl-5-methyl-N-Boc-piperazine Preparation Products And Raw materials |
|