CreatineGluconate manufacturers
- Creatine Gluconate
-
- $0.00 / 25Kg/Drum
-
2025-12-29
- CAS:306274-45-3
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 1000kg
|
| | CreatineGluconate Basic information |
| Product Name: | CreatineGluconate | | Synonyms: | CreatineGluconate;D-Gluconic acid creatine salt;Creatine Glutarate | | CAS: | 306274-45-3 | | MF: | C10H19N3O8 | | MW: | 309.27316 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | CreatineGluconate Chemical Properties |
| InChI | InChI=1/C10H19N3O8/c1-13(10(11)12)2-5(16)21-9(20)8(19)7(18)6(17)4(15)3-14/h4,6-8,14-15,17-19H,2-3H2,1H3,(H3,11,12)/t4-,6-,7+,8-/s3 | | InChIKey | GSQPKYCCYPSNNU-YEZNIHIWNA-N | | SMILES | CN(CC(OC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)=O)C(=N)N |&1:7,8,9,10,r| |
| | CreatineGluconate Usage And Synthesis |
| | CreatineGluconate Preparation Products And Raw materials |
|