| Company Name: |
Suzhou Yibide Biotechnology Co., Ltd.
|
| Tel: |
0512-65806034 18914030027 18914030027 |
| Email: |
manager@eebetter.com |
| Products Intro: |
Product Name:2-[[9-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-9H-xanthen-3-yl]oxy]acetic acid CAS:156147-89-6 Purity:97% Package:1克/RMB 3700;10克/RMB 32000
|
Acetic acid, 2-[[9-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-9H-xanthen-3-yl]oxy]- manufacturers
|
| | Acetic acid, 2-[[9-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-9H-xanthen-3-yl]oxy]- Basic information |
| | Acetic acid, 2-[[9-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-9H-xanthen-3-yl]oxy]- Chemical Properties |
| Boiling point | 713.6±60.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | pka | 3.12±0.10(Predicted) | | InChIKey | VXJCZGMHOUAFRL-UHFFFAOYSA-N | | SMILES | C(O)(=O)COC1=CC2OC3=C(C(NC(OCC4C5=C(C=CC=C5)C5=C4C=CC=C5)=O)C=2C=C1)C=CC=C3 |
| | Acetic acid, 2-[[9-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-9H-xanthen-3-yl]oxy]- Usage And Synthesis |
| | Acetic acid, 2-[[9-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-9H-xanthen-3-yl]oxy]- Preparation Products And Raw materials |
|