- Diphenyl phthalate
-
- $0.00 / 1KG
-
2026-02-13
- CAS:84-62-8
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- DIPHENYL PHTHALATE
-
- $30.00 / 1kg
-
2025-05-26
- CAS:84-62-8
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 100000kg
- DIPHENYL PHTHALATE
-
- $9.80 / 1.79999995231628KG
-
2020-01-05
- CAS:84-62-8
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | DIPHENYL PHTHALATE Basic information |
| | DIPHENYL PHTHALATE Chemical Properties |
| Melting point | 74-76 °C(lit.) | | Boiling point | 400-405°C | | density | 1,28 g/cm3 | | refractive index | 1.5400 (estimate) | | Fp | 224°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystalline | | color | White | | Specific Gravity | approximate 1.28 (20℃) | | Water Solubility | 82ug/L(24 ºC) | | Merck | 14,7306 | | BRN | 2473390 | | Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care | | InChI | 1S/C20H14O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h1-14H | | InChIKey | DWNAQMUDCDVSLT-UHFFFAOYSA-N | | SMILES | O=C(Oc1ccccc1)c2ccccc2C(=O)Oc3ccccc3 | | CAS DataBase Reference | 84-62-8(CAS DataBase Reference) | | EPA Substance Registry System | Diphenyl phthalate (84-62-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-26 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 2 | | RTECS | TI1935000 | | TSCA | TSCA listed | | HazardClass | 9 | | HS Code | 29173490 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DIPHENYL PHTHALATE Usage And Synthesis |
| Chemical Properties | white powder | | Uses | Plasticizer in nitrocellulose lacquers. | | Definition | ChEBI: The diphenyl ester of benzene-1,2-dicarboxylic acid. |
| | DIPHENYL PHTHALATE Preparation Products And Raw materials |
|