3,5-Difluoro-4-(trifluoromethoxy)bromobenzene manufacturers
|
| | 3,5-Difluoro-4-(trifluoromethoxy)bromobenzene Basic information | | Uses |
| Product Name: | 3,5-Difluoro-4-(trifluoromethoxy)bromobenzene | | Synonyms: | 5-Bromo-1,3-difluoro-2-(trifluoromethoxy)benzene;2,6-Difluoro-4-bromotrifluoromethoxybenzene;3,5-Difluoro-4-(trifluoromethoxy)bromobenzene;4-BroMo-2,6-difluoro(trifluoroMethoxy)benzene;4-Bromo-2,6-fluorotrifluoromethoxybenzene;4-Bromo-2,6-difluoro-1-(trifluoromethoxy)benzene;Benzene, 5-bromo-1,3-difluoro-2-(trifluoromethoxy)-;5-Difluoro-4-(trifluoromethoxy)bromobenzene | | CAS: | 115467-07-7 | | MF: | C7H2BrF5O | | MW: | 276.99 | | EINECS: | | | Product Categories: | | | Mol File: | 115467-07-7.mol |  |
| | 3,5-Difluoro-4-(trifluoromethoxy)bromobenzene Chemical Properties |
| Boiling point | 175.3±35.0 °C(Predicted) | | density | 1.793±0.06 g/cm3(Predicted) | | refractive index | 1.4330 to 1.4370 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C7H2BrF5O/c8-3-1-4(9)6(5(10)2-3)14-7(11,12)13/h1-2H | | InChIKey | ORHCJZZKAUAZDR-UHFFFAOYSA-N | | SMILES | C1(F)=CC(Br)=CC(F)=C1OC(F)(F)F |
| | 3,5-Difluoro-4-(trifluoromethoxy)bromobenzene Usage And Synthesis |
| Uses | 4-Bromo-2,6-difluoro-trifluoromethoxybenzene is an increasingly widely used intermediate in the synthesis of liquid crystal compounds. | | Chemical Properties | Colorless transparent liquid |
| | 3,5-Difluoro-4-(trifluoromethoxy)bromobenzene Preparation Products And Raw materials |
|