|
|
| | Ethyl (1S,2R)-2-aminocyclopentanecarboxylate Basic information |
| Product Name: | Ethyl (1S,2R)-2-aminocyclopentanecarboxylate | | Synonyms: | Cyclopentanecarboxylic acid, 2-amino-, ethyl ester, (1S-cis)- (9CI);Ethyl (1S,2R)-2-AMinocyclopentanecarboxylate;Cyclopentanecarboxylic acid, 2-amino-, ethyl ester, (1S,2R)-;Ethyl (1S,2R)-2-Aminocyclopentanecarboxylate, ≥95% | | CAS: | 197904-11-3 | | MF: | C8H15NO2 | | MW: | 157.21 | | EINECS: | | | Product Categories: | CARBOXYLICESTER | | Mol File: | 197904-11-3.mol |  |
| | Ethyl (1S,2R)-2-aminocyclopentanecarboxylate Chemical Properties |
| Boiling point | 213.4±33.0 °C(Predicted) | | density | 1.045±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | pka | 10.10±0.40(Predicted) | | InChI | InChI=1S/C8H15NO2/c1-2-11-8(10)6-4-3-5-7(6)9/h6-7H,2-5,9H2,1H3/t6-,7+/m0/s1 | | InChIKey | AGCJYTRMZBPEEO-NKWVEPMBSA-N | | SMILES | [C@H]1(C(OCC)=O)CCC[C@H]1N |
| | Ethyl (1S,2R)-2-aminocyclopentanecarboxylate Usage And Synthesis |
| Uses | Ethyl (1S,2R)-2-aminocyclopentanecarboxylate is a heterocyclic compound mainly used in organic synthesis. |
| | Ethyl (1S,2R)-2-aminocyclopentanecarboxylate Preparation Products And Raw materials |
|