|
|
| | Benzaldehyde, 3-fluoro-5-methoxy- (9CI) Basic information |
| Product Name: | Benzaldehyde, 3-fluoro-5-methoxy- (9CI) | | Synonyms: | Benzaldehyde, 3-fluoro-5-methoxy- (9CI);3-Fluoro-5-methoxybenzaldehyde 97%;3-Fluoro-5-methoxybenzaldehyde97%;5-Fluoro-m-anisaldehyde, 3-Fluoro-5-formylanisole;5-Fluoro-3-methoxybenzaldehyde;Benzaldehyde, 3-fluoro-5-Methoxy-;3-fluoranyl-5-methoxy-benzaldehyde | | CAS: | 699016-24-5 | | MF: | C8H7FO2 | | MW: | 154.14 | | EINECS: | | | Product Categories: | HALIDE;ALDEHYDE | | Mol File: | 699016-24-5.mol |  |
| | Benzaldehyde, 3-fluoro-5-methoxy- (9CI) Chemical Properties |
| Melting point | 24-29℃ | | Boiling point | 216℃ | | density | 1.192 | | Fp | 82℃ | | storage temp. | Inert atmosphere,2-8°C | | form | fused solid | | color | Faint yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C8H7FO2/c1-11-8-3-6(5-10)2-7(9)4-8/h2-5H,1H3 | | InChIKey | IBKNUJGSSUDSSJ-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(OC)=CC(F)=C1 | | CAS DataBase Reference | 699016-24-5 |
| Hazard Codes | Xi | | HS Code | 2912490090 |
| | Benzaldehyde, 3-fluoro-5-methoxy- (9CI) Usage And Synthesis |
| Chemical Properties | light yellow liquid |
| | Benzaldehyde, 3-fluoro-5-methoxy- (9CI) Preparation Products And Raw materials |
|