|
|
| | Guanosine 5'-triphosphate trisodium salt Basic information |
| Product Name: | Guanosine 5'-triphosphate trisodium salt | | Synonyms: | Guanosine 5′-triphosphate sodium salt hydrate;GUANOSINE-5'-TRIPHOSPHATE TETRASODIUM SALT;5'-triphosphate trisodium salt;GTP, trisodium salt, ≥96%(HPLC);guanosine 5'-triphosphate sodium salt solution;Guanosine 5'-(tetrahydrogen triphosphate), trisodium salt;GUANOSINE 5'-TRIPHOSPHATE SODIUM 100 MM SOLUTION MO;GUANOSINE 5'-TRIPHOSPHATE SODIUM*PREPARE D ENZYMATIC | | CAS: | 36051-31-7 | | MF: | C10H17N5NaO14P3 | | MW: | 547.18 | | EINECS: | 252-847-2 | | Product Categories: | Pharmaceutical;NTP | | Mol File: | 36051-31-7.mol |  |
| | Guanosine 5'-triphosphate trisodium salt Chemical Properties |
| Melting point | 254 - 256°C | | storage temp. | -20°C | | solubility | H2O: 50 mg/mL | | form | powder | | color | white | | biological source | Porcine brain bacterial (Corynebacterium) yeast | | Optical Rotation | [α]20/D 24±2°, c = 1% in 0.5 M Na2HPO4 | | Water Solubility | H2O: 50mg/mL | | BRN | 4113439 | | Stability: | Hygroscopic | | InChIKey | XIZYETZGWBYYEH-NGPBCCOENA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(NC(N)=NC1=2)=O)O.[NaH] |&1:1,2,3,19,r| | | CAS DataBase Reference | 36051-31-7(CAS DataBase Reference) |
| | Guanosine 5'-triphosphate trisodium salt Usage And Synthesis |
| Uses | Guanosine 5′-triphosphate sodium salt solution has been used for reconstituting transducin during purification of transducin.
| | General Description | GTP is supplied as the disodium salt in crystal form. | | Biochem/physiol Actions | GTP functions as a carrier of phosphates and pyrophosphates involved in channeling chemical energy into specific biosynthetic pathways. GTP activates the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades. Proliferation and apoptosis are regulated in part by the hydrolysis of GTP by small GTPases Ras and Rho. Another type of small GTPase, Rab, plays a role in the docking and fusion of vesicles and may also be involved in vesicle formation. In addition to its role in signal transduction, GTP also serves as an energy-rich precursor of mononucleotide units in the enzymatic biosynthesis of DNA and RNA. | | IC 50 | Human Endogenous Metabolite |
| | Guanosine 5'-triphosphate trisodium salt Preparation Products And Raw materials |
|