|
|
| | 6-Trifluoromethyl-imidazo[1,2-a]pyridine Basic information |
| | 6-Trifluoromethyl-imidazo[1,2-a]pyridine Chemical Properties |
| Melting point | 98-99° | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.92±0.50(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C8H5F3N2/c9-8(10,11)6-1-2-7-12-3-4-13(7)5-6/h1-5H | | InChIKey | NQIVIKBUQJRSQP-UHFFFAOYSA-N | | SMILES | FC(F)(F)C1=CN2C=CN=C2C=C1 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 6-Trifluoromethyl-imidazo[1,2-a]pyridine Usage And Synthesis |
| | 6-Trifluoromethyl-imidazo[1,2-a]pyridine Preparation Products And Raw materials |
|