|
|
| | Sitostanol-5,6,22,23-D4 Basic information |
| Product Name: | Sitostanol-5,6,22,23-D4 | | Synonyms: | Sitostanol-5,6,22,23-D4;Sitostanol-5,6,22,23-d4;5,6,22,23-2H4]-β-Sitostanol | | CAS: | 150044-25-0 | | MF: | C29H52O | | MW: | 416.73 | | EINECS: | | | Product Categories: | Sitostanol & Sitosterol | | Mol File: | 150044-25-0.mol |  |
| | Sitostanol-5,6,22,23-D4 Chemical Properties |
| form | solid | | InChIKey | LGJMUZUPVCAVPU-DRBICYPTSA-N | | SMILES | [2H]C1C[C@H]2[C@@H]3CC[C@H]([C@H](C)C([2H])C([2H])[C@@H](CC)C(C)C)[C@@]3(C)CC[C@@H]2[C@@]4(C)CC[C@H](O)C[C@]14[2H] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Sitostanol-5,6,22,23-D4 Usage And Synthesis |
| Uses | - Mass spectrometry calibration - Advanced materials research and development - reaction mechanism investigations - Chemical synthesis of labeled compounds |
| | Sitostanol-5,6,22,23-D4 Preparation Products And Raw materials |
|