|
|
| | O-PHOSPHO-L-TYROSINE Basic information |
| | O-PHOSPHO-L-TYROSINE Chemical Properties |
| Melting point | 226-227°C | | Boiling point | 521.7±60.0 °C(Predicted) | | density | 1.591±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Aqueous Acid (Slightly), Water (Slightly, Sonicated) | | pka | 1.24±0.30(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | -9.6° (C=0.01 g/ml, 1N HCL) | | BRN | 3150815 | | InChI | 1S/C9H12NO6P/c10-8(9(11)12)5-6-1-3-7(4-2-6)16-17(13,14)15/h1-4,8H,5,10H2,(H,11,12)(H2,13,14,15)/t8-/m0/s1 | | InChIKey | DCWXELXMIBXGTH-QMMMGPOBSA-N | | SMILES | N[C@@H](Cc1ccc(OP(O)(O)=O)cc1)C(O)=O | | CAS DataBase Reference | 21820-51-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | O-PHOSPHO-L-TYROSINE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | O-Phospho-L-tyrosine is used in the study of tyrosine-phosphorylation, which has been linked to the malignant transformation of cells by various RNA tumor viruses. Plays a role in signal transduction. | | Definition | ChEBI: A non-proteinogenic L-alpha-amino acid that is L-tyrosine phosphorylated at the phenolic hydroxy group. | | Biological Activity | Phosphotyrosine acts as a docking site in protein regulation by stimulating interaction between tyrosine-phosphorylated proteins and phosphotyrosine domains of other proteins. | | Purification Methods | Purify it by recrystallisation from H2O or H2O/EtOH. [Levene & Schormüller J Biol Chem 100 583 1933, Posternak & Graff Helv Chim Acta 28 1258 1945, Beilstein 14 III 1510.] |
| | O-PHOSPHO-L-TYROSINE Preparation Products And Raw materials |
|