FMOC-GLY-OPFP manufacturers
- FMOC-GLY-OPFP
-
- $1.00
-
2020-03-12
- CAS:86060-85-7
- Min. Order: 100KG
- Purity: 99.0%
- Supply Ability: 1000kg
|
| | FMOC-GLY-OPFP Basic information |
| Product Name: | FMOC-GLY-OPFP | | Synonyms: | FMOC-GLYCINE PENTAFLUOROPHENYL ESTER;FMOC-GLYCINE-OPFP;FMOC-GLY-OPFP;N-FMOC-GLYCINE PENTAFLUOROPHENYL ESTER;N-ALPHA-FMOC-GLYCINE PENTAFLUOROPHENYL ESTER 98%;NALPHA-9-Fluorenylmethoxycarbonylglycine pentafluorophenyl ester;N-(9-fluorenylmethoxycarbonyl)glycine pentafluorophenyl;FMOC-Glycine pentafluorophenyl ester,97% | | CAS: | 86060-85-7 | | MF: | C23H14F5NO4 | | MW: | 463.35 | | EINECS: | | | Product Categories: | Glycine [Gly, G];Fmoc-Amino Acids and Derivatives;Amino Acids | | Mol File: | 86060-85-7.mol |  |
| | FMOC-GLY-OPFP Chemical Properties |
| Melting point | 159-160 °C | | density | 1.4222 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C23H14F5NO4/c24-17-18(25)20(27)22(21(28)19(17)26)33-16(30)9-29-23(31)32-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15H,9-10H2,(H,29,31) | | InChIKey | LBSDTBJWUJIFBO-UHFFFAOYSA-N | | SMILES | Fc1c(c(c(c(c1F)F)OC(=O)CNC(=O)OCC2c3c(cccc3)c4c2cccc4)F)F | | CAS DataBase Reference | 86060-85-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | FMOC-GLY-OPFP Usage And Synthesis |
| Chemical Properties | white fluffy crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-GLY-OPFP Preparation Products And Raw materials |
|