- Fmoc-L-Ser(bzl)-OH
-
- $0.00/ kg
-
2026-04-01
- CAS:83792-48-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Fmoc-O-benzyl-L-serine Basic information |
| | Fmoc-O-benzyl-L-serine Chemical Properties |
| Boiling point | 642.4±55.0 °C(Predicted) | | density | 1.279±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.41±0.10(Predicted) | | color | Pale brown | | Optical Rotation | Consistent with structure | | InChIKey | DYBDGLCDMLNEMJ-QHCPKHFHSA-N | | SMILES | C(O)(=O)[C@H](COCC1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 83792-48-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29242990 |
| | Fmoc-O-benzyl-L-serine Usage And Synthesis |
| Uses | Fmoc-O-benzyl-L-serine is used in preparation of Cyclic Peptide antibiotics. |
| | Fmoc-O-benzyl-L-serine Preparation Products And Raw materials |
|