| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Amoxapine-d8 Basic information |
| | Amoxapine-d8 Chemical Properties |
| Melting point | 175-1760C | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Beige | | Major Application | clinical testing | | InChI | 1S/C17H16ClN3O/c18-12-5-6-15-13(11-12)17(21-9-7-19-8-10-21)20-14-3-1-2-4-16(14)22-15/h1-6,11,19H,7-10H2/i7D2,8D2,9D2,10D2 | | InChIKey | QWGDMFLQWFTERH-UFBJYANTSA-N | | SMILES | Clc1cc2c(cc1)Oc3c(cccc3)N=C2N4C(C(NC(C4([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H] |
| Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | Amoxapine-d8 Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | Antidepressant |
| | Amoxapine-d8 Preparation Products And Raw materials |
|