|
|
| | N-[4-(-Carboxycyclohexylmethyl)]maleimide Basic information |
| Product Name: | N-[4-(-Carboxycyclohexylmethyl)]maleimide | | Synonyms: | 4-[(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)methyl]Cyclohexanecarboxylic acid;4-(N-Maleimidomethyl)cyclohexane-1-carboxylic acid 95%;4-(N-MaleiMidoMethyl)cyclohexanecarboxylic acid;4-(Maleimidomethyl)cyclohexanecarboxylic Acid
(Discontinued, see C177860);4-((2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl)cyclohexanecarboxylic acid;4-((2,5-dioxo-2H-pyrrol-1(5H)-yl)methyl)cyclohexanecarboxylic acid;4-((2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl);4-[(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid | | CAS: | 64987-82-2 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | | | Product Categories: | Cross Linking Reagents;Maleimide Derivatives;MTS & Sulfhydryl Active Reagents;satralizumab-linker | | Mol File: | 64987-82-2.mol | ![N-[4-(-Carboxycyclohexylmethyl)]maleimide Structure](CAS/GIF/64987-82-2.gif) |
| | N-[4-(-Carboxycyclohexylmethyl)]maleimide Chemical Properties |
| Melting point | 157-158°C | | Boiling point | 433.6±18.0 °C(Predicted) | | density | 1.329±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, Methanol | | form | Solid | | pka | 4.80±0.10(Predicted) | | color | Pale Yellow | | InChI | InChI=1S/C12H15NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17/h5-6,8-9H,1-4,7H2,(H,16,17) | | InChIKey | LQILVUYCDHSGEU-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)CCC(CN2C(=O)C=CC2=O)CC1 |
| | N-[4-(-Carboxycyclohexylmethyl)]maleimide Usage And Synthesis |
| Description | 4-((2,5-Dioxo-2H-pyrrol-1(5H)-yl)methyl)cyclohexanecarboxylic acid contains a maleimide group and a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. | | Chemical Properties | White Solid | | Uses | An amino reactive reagent. | | Uses | A sulfhydryl crosslinking reagent. | | Definition | N-(4-Carboxycyclohexylmethyl)maleimide is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein.
| | IC 50 | Alkyl-Chain |
| | N-[4-(-Carboxycyclohexylmethyl)]maleimide Preparation Products And Raw materials |
|