Company Name: |
Capot Chemical Co.,Ltd. |
Tel: |
+8613336195806 |
Email: |
sales@capot.com |
Products Intro: |
Product Name:2,8-Dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole CAS:19686-05-6 Purity:98% (Min,HPLC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| 2,8-Dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole Basic information |
| 2,8-Dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole Chemical Properties |
Melting point | 98-100 °C | Boiling point | 342.1±37.0 °C(Predicted) | density | 1.137±0.06 g/cm3(Predicted) | storage temp. | 2-8°C | pka | 17.59±0.20(Predicted) | Appearance | Yellow to brown Solid | InChI | InChI=1S/C13H16N2/c1-9-3-4-12-10(7-9)11-8-15(2)6-5-13(11)14-12/h3-4,7,14H,5-6,8H2,1-2H3 | InChIKey | MUZFLDUALLSEBH-UHFFFAOYSA-N | SMILES | N1C2=C(C=C(C)C=C2)C2CN(C)CCC1=2 |
| 2,8-Dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole Usage And Synthesis |
Uses | 2,8-dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| 2,8-Dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole Preparation Products And Raw materials |
|