| Company Name: |
Musechem |
| Tel: |
+1-800-259-7612 |
| Email: |
info@musechem.com |
4H-Pyrrolo3,2-dpyrimidin-4-one, 7-(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-pyrrolidinyl-1,5-dihydro-, monohydrochloride manufacturers
|
| | 4H-Pyrrolo3,2-dpyrimidin-4-one, 7-(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-pyrrolidinyl-1,5-dihydro-, monohydrochloride Basic information |
| Product Name: | 4H-Pyrrolo3,2-dpyrimidin-4-one, 7-(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-pyrrolidinyl-1,5-dihydro-, monohydrochloride | | Synonyms: | 4H-Pyrrolo3,2-dpyrimidin-4-one, 7-(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-pyrrolidinyl-1,5-dihydro-, monohydrochloride;Forodesine hydrochloride;BCX-1777;Immucillin-H hydrochloride;Forodesine HCl;BCX-1777 hydrochloride;Fodosine Hydrochloride | | CAS: | 284490-13-7 | | MF: | C11H15ClN4O4 | | MW: | 302.72 | | EINECS: | | | Product Categories: | | | Mol File: | 284490-13-7.mol |  |
| | 4H-Pyrrolo3,2-dpyrimidin-4-one, 7-(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-pyrrolidinyl-1,5-dihydro-, monohydrochloride Chemical Properties |
| Melting point | 268-270°C | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | Off-White to Pale Beige | | Stability: | Hygroscopic | | SMILES | O=C1C2=C(NC=N1)C([C@@H]3N[C@@H]([C@H]([C@H]3O)O)CO)=CN2.Cl |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4H-Pyrrolo3,2-dpyrimidin-4-one, 7-(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-pyrrolidinyl-1,5-dihydro-, monohydrochloride Usage And Synthesis |
| Uses | Treatment of T-Cell malignancies such as acute lymphoblastic leukemia (ALL) and cutaneous T-cell lymphoma. | | Uses | Fodosine Hydrochloride is a 23-pM inhibitor of bovine purine nucleoside phosphorylase (PNP) specifically designed as a transition state mimic. | | Biological Activity | Forodesine (BCX-1777; ImmH; Immucillin-H) is an orally active, tight-binding (bovine/human PNP Ki = 23/72 pM) and highly potent purine nucleoside phosphorylase (PNP, PNPase) inhibtor (IC50 in nM = 0.48/mouse, 0.66/monkey, 1.19/human, 1.24/rat, 1.57/dog) th at mimics the PNP transition-state structure. Forodesine inhibits human T-cell proliferation stimulated by IL-2, MLR- and PHA in cultures (IC50 in the presence of 10 μM dGuo = 60, 50, and 387 nM, respectively) and shows in vivo efficacy in a xenogeneic graft vs. host disease model using hu-PBL SCID mice (20 mg/kg b.i.d. p.o.). | | in vivo | Forodesine (BCX-1777) has excellent oral bioavailability (63%) in mice[2].
At a single dose of 10 mg/kg in mice, Forodesine elevates dGuo to approximately 5 μM[2].
n the human peripheral blood lymphocyte severe combined immunodeficiency (hu-PBL-SCID) mouse model, Forodesine is effective in prolonging the life span 2-fold or more[2]. |
| | 4H-Pyrrolo3,2-dpyrimidin-4-one, 7-(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-pyrrolidinyl-1,5-dihydro-, monohydrochloride Preparation Products And Raw materials |
|