| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Products Intro: |
Product Name:3-Deoxy-2-keto-6-phospho-D-gluconate lithium salt
CAS:27244-54-8
Purity:94%
|
| Company Name: |
SHANGHAI ZZBIO CO., LTD.
|
| Tel: |
18019219489 18901678489 |
| Email: |
tech@zzbioco.com |
| Products Intro: |
Product Name:3-Deoxy-2-keto-6-phospho-D-gluconate lithium
CAS:27244-54-8
Purity:N/A Package:5mg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:3-Deoxy-2-keto-6-phosphogluconic acid lithium salt
CAS:27244-54-8
|
|
| | 4,5-dihydroxy-2-oxo-6-phosphonooxy-hexanoic acid Basic information |
| Product Name: | 4,5-dihydroxy-2-oxo-6-phosphonooxy-hexanoic acid | | Synonyms: | 4,5-dihydroxy-2-oxo-6-phosphonooxy-hexanoic acid;2-Keto-3-deoxy-6-phosphogluconate;2-Keto-2,3-dideoxy-6-O-phosphono-D-gluconic acid;3-Deoxy-D-erythro-2-hexulosonic acid 6-phosphoric acid;KDPG;(4S,5R)-4,5-Dihydroxy-2-oxo-6-phosphonooxyhexanoic acid lithium salt;2-Dehydro-3-deoxy-6-phospho-D-gluconate lithium salt;2-Keto-3-deoxy-6-phosphogluconate lithium salt | | CAS: | 27244-54-8 | | MF: | C6H11O9P | | MW: | 258.12 | | EINECS: | | | Product Categories: | | | Mol File: | 27244-54-8.mol |  |
| | 4,5-dihydroxy-2-oxo-6-phosphonooxy-hexanoic acid Chemical Properties |
| storage temp. | -20°C | | form | powder | | color | white | | Optical Rotation | [α]/D 9.0±1.0°, 3 hr, c = 0.1 in H2O | | InChI | 1S/C6H11O9P/c7-3(1-4(8)6(10)11)5(9)2-15-16(12,13)14/h3,5,7,9H,1-2H2,(H,10,11)(H2,12,13,14)/t3-,5+/m0/s1 | | InChIKey | OVPRPPOVAXRCED-WVZVXSGGSA-N | | SMILES | [P](=O)(OC[C@@H](O)[C@@H](O)CC(=O)C(=O)O)(O)O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 4,5-dihydroxy-2-oxo-6-phosphonooxy-hexanoic acid Usage And Synthesis |
| Definition | ChEBI: The 5-phospho derivative of 2-dehydro-D-gluconic acid. | | Biological Activity | 2-dehydro-3-deoxy-phosphogluconate is a substrate for the enzyme 2-dehydro-3-deoxy-phosphogluconate aldolase which converts it into D-glyceraldehyde 3-phosphate plus pyruvate. ', 'Metabolite in the pentose phosphate pathway, generating NADPH and pentoses; and in the in pentose and glucuronate interconversions; key intermediate in the Entner-Doudoroff pathway of some bacteria, substrate of 2-Keto-3-deoxy-6-phosphogluconate (KDPG) aldolase, catalyzing the reversible cleavage of KDPG to pyruvate and glyceraldehyde-3-phosphate. It was found to be the carbon catabolite repression signal of phenylacetic acid metabolism in P. putida KT2440. Expression from Pu was repressed mainly via PtsN in response to high levels of 2-dehydro-3-deoxygluconate-6-phosphate. |
| | 4,5-dihydroxy-2-oxo-6-phosphonooxy-hexanoic acid Preparation Products And Raw materials |
|