3-hydroxy-2-methyl-Butanoic acid manufacturers
|
| | 3-hydroxy-2-methyl-Butanoic acid Basic information |
| Product Name: | 3-hydroxy-2-methyl-Butanoic acid | | Synonyms: | 3-Hydroxy-2-methylbutyric acid;2,3-Dimethyl-3-hydroxypropionic acid;2-Methyl-3-hydroxybutyric acid;3-hydroxy-2-methyl-Butanoic acid;Nilic acid;3-Hydroxy-2-methylbutanoic Acid (2-Methyl-3-hydroxybutyric Acid);3-Hydroxy-2-methylbutyric acid, mixture of isomers;Butanoic acid, 3-hydroxy-2-methyl- | | CAS: | 473-86-9 | | MF: | C5H10O3 | | MW: | 118.13 | | EINECS: | | | Product Categories: | Aliphatics | | Mol File: | 473-86-9.mol |  |
| | 3-hydroxy-2-methyl-Butanoic acid Chemical Properties |
| Boiling point | 242.8±23.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | pK1:4.648 (18°C) | | form | Oil | | color | Colourless to Yellow | | InChI | InChI=1S/C5H10O3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3,(H,7,8) | | InChIKey | VEXDRERIMPLZLU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C)C(O)C |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | 3-hydroxy-2-methyl-Butanoic acid Usage And Synthesis |
| Chemical Properties | Pale orange Oil | | Uses | 3-Hydroxy-2-methylbutanoic Acid (cas# 473-86-9) is a compound useful in organic synthesis. | | Definition | ChEBI: A 3-hydroxy monocarboxylic acid that is butyric acid which is substituted by a methyl group and a hydroxy group at positions 2 and 3, respectively. |
| | 3-hydroxy-2-methyl-Butanoic acid Preparation Products And Raw materials |
|