| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
|
| | (2S)-2-[[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]butanedioic acid Basic information |
| Product Name: | (2S)-2-[[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]butanedioic acid | | Synonyms: | (2S)-2-[[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]butanedioic acid;N-[[5-Amino-1-(5-O-phosphono-β-D-ribofuranosyl)-1H-imidazol-4-yl]carbonyl]-L-aspartic acid;Succino-AICAR;2-[[1-(5-O-Phosphono-β-D-ribofuranosyl)-5-amino-1H-imidazol]-4-ylcarbonylamino]succinic acid;5-Aminoimidazole-4-N-succinocarboxamide ribonucleotide;5'-Phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole;N-Succinyl-5-aMinoiMidazole-4-carboxaMide Ribose 5'-Phosphate;L-Aspartic acid, N-[[5-amino-1-(5-O-phosphono-β-D-ribofuranosyl)-1H-imidazol-4-yl]carbonyl]- | | CAS: | 3031-95-6 | | MF: | C13H19N4O12P | | MW: | 454.28 | | EINECS: | | | Product Categories: | | | Mol File: | 3031-95-6.mol | ![(2S)-2-[[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]butanedioic acid Structure](CAS/GIF/3031-95-6.gif) |
| | (2S)-2-[[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]butanedioic acid Chemical Properties |
| Melting point | >189°C (dec.) | | density | 2.18±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 1.86±0.10(Predicted) | | color | White to Off-White | | biological source | synthetic | | Stability: | Hygroscopic | | Major Application | metabolomics | | InChIKey | NAQGHJTUZRHGAC-ZZZDFHIKSA-N | | SMILES | NC1=C(N=CN1[C@H]2[C@H](O)[C@H](O)[C@@H](COP(O)(O)=O)O2)C(N[C@@H](CC(O)=O)C(O)=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (2S)-2-[[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]butanedioic acid Usage And Synthesis |
| Uses | N-Succinyl-5-aminoimidazole-4-carboxamide Ribose 5’-Phosphate is a metabolite of Purine. Since adenosine is a potent inhibitor of neuronal function, depressing the release of several excitatory transmitters and causing direct hyperpolarization of neurons, it was possible that the symptoms seen in adenylosuccinate lyase (ASase) deficient patients could reflect an interference of succinylpurines with neurotransmission. | | Definition | ChEBI: A 1-(phosphoribosyl)imidazolecarboxamide resulting from the formal condesation of the darboxy group of 5-amino-1-(5-O-phosphono-beta-D-ribofuranosyl)-1H-imidazole-4-carboxylic acid wit
the amino group of L-aspartic acid. | | IC 50 | Human Endogenous Metabolite |
| | (2S)-2-[[5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]butanedioic acid Preparation Products And Raw materials |
|