|
| NSC 87241 Basic information |
Product Name: | NSC 87241 | Synonyms: | NSC 87241;2-Nitro-1H-pyrrole;2-Nitropyrrole;1H-Pyrrole, 2-nitro- | CAS: | 5919-26-6 | MF: | C4H4N2O2 | MW: | 112.09 | EINECS: | | Product Categories: | | Mol File: | 5919-26-6.mol |  |
| NSC 87241 Chemical Properties |
Melting point | 55 °C | Boiling point | 100-120 °C | density | 1.408±0.06 g/cm3(Predicted) | storage temp. | 2-8°C | pka | 13.66±0.50(Predicted) | Appearance | Off-white to yellow Solid | InChI | InChI=1S/C4H4N2O2/c7-6(8)4-2-1-3-5-4/h1-3,5H | InChIKey | FTBBGQKRYUTLMP-UHFFFAOYSA-N | SMILES | N1C=CC=C1[N+]([O-])=O |
| NSC 87241 Usage And Synthesis |
| NSC 87241 Preparation Products And Raw materials |
|