|
|
| | 4-BROMO-2-FLUOROBENZYL ALCOHOL Basic information |
| | 4-BROMO-2-FLUOROBENZYL ALCOHOL Chemical Properties |
| Melting point | 30-35 °C | | Boiling point | 262℃ | | density | 1.658 | | refractive index | 1.5450 (estimate) | | Fp | 113℃ | | storage temp. | Store at room temperature | | pka | 13.68±0.10(Predicted) | | form | powder | | color | Off-white to pale yellow/brown | | BRN | 7757667 | | InChI | InChI=1S/C7H6BrFO/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2 | | InChIKey | BWBJZMQPVBWEJU-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(Br)C=C1F | | CAS DataBase Reference | 188582-62-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 24/25-26 | | WGK Germany | 2 | | Hazard Note | Irritant | | HS Code | 29062900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-BROMO-2-FLUOROBENZYL ALCOHOL Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline powder or chunks |
| | 4-BROMO-2-FLUOROBENZYL ALCOHOL Preparation Products And Raw materials |
|