|
|
| | 2-Chloro-5-(trifluoromethyl)isonicotinic acid 97% Basic information |
| Product Name: | 2-Chloro-5-(trifluoromethyl)isonicotinic acid 97% | | Synonyms: | 2-Chloro-5-(trifluoromethyl)pyridine-4-carboxylic acid, 4-Carboxy-2-chloro-5-(trifluoromethyl)pyridine;2-chloro -5-three fluorineMethylisonicotinate;2-CHLORO-5-(TRIFLUOROMETHYL)PYRIDINE-4-CARBOXLIC ACID;4-Pyridinecarboxylic acid, 2-chloro-5-(trifluoromethyl)-;2-Chloro-5-(trifluoromethyl)pyridine-4-carboxylicacid,97%;2-Chloro-5-(trifluoromethyl)isonicotinic acid 97% ISO 9001：2015 REACH | | CAS: | 505084-58-2 | | MF: | C7H3ClF3NO2 | | MW: | 225.55 | | EINECS: | | | Product Categories: | Fluorine series;Carboxylic Acids;Pyridines | | Mol File: | 505084-58-2.mol |  |
| | 2-Chloro-5-(trifluoromethyl)isonicotinic acid 97% Chemical Properties |
| Melting point | 185-186°C | | Boiling point | 376.7±42.0 °C(Predicted) | | density | 1.603±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.05±0.36(Predicted) | | form | Solid | | Appearance | White to light yellow Solid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C7H3ClF3NO2/c8-5-1-3(6(13)14)4(2-12-5)7(9,10)11/h1-2H,(H,13,14) | | InChIKey | OIODRBHIESSYRO-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(F)(F)F)C(C(O)=O)=C1 |
| Hazard Codes | Xi | | RIDADR | UN2811 | | HS Code | 2933599590 |
| | 2-Chloro-5-(trifluoromethyl)isonicotinic acid 97% Usage And Synthesis |
| Uses | It plays an important role for intermediate for pharmaceutical, organic synthesis and organic light-emitting diode(OLED). |
| | 2-Chloro-5-(trifluoromethyl)isonicotinic acid 97% Preparation Products And Raw materials |
|