|
|
| | cis-3-(Boc-amino)cyclohexanecarboxylic acid Basic information |
| Product Name: | cis-3-(Boc-amino)cyclohexanecarboxylic acid | | Synonyms: | (R,S)-CIS-1-(TERT-BUTYLOXYCARBONYL-AMINO)-CYCLOHEXYL-3-CARBOXYLIC ACID;CIS-(R,S)-(TERT-BUTYLOXYCARBONYLAMINO)-CYCLOHEXYL-CARBOXYLIC ACID;CIS-(R,S)-(T-BUTYLOXYCARBONYLAMINO)-CYCLOHEXYL-CARBOXYLIC ACID;(R,S)-cis-1-(t-Butyloxycarbonyl-amino)-cyclohexyl-3-carboxylic acid;CIS-3-TERT-BUTOXYCARBONYLAMINOCYCLOHEXANECARBOXYLIC ACID;BOC-(+/-)-CIS-3-AMINOCYCLOHEXANE-1-CARBOXYLIC ACID;BOC-CIS-3-AMINOCYCLOHEXANE CARBOXYLIC ACID;BOC-CIS-1,3-AMINOCYCLOHEXANE CARBOXYLIC ACID | | CAS: | 222530-33-8 | | MF: | C12H21NO4 | | MW: | 243.3 | | EINECS: | | | Product Categories: | Beta-Amino Acids;Peptide Synthesis;Unnatural Amino Acid Derivatives | | Mol File: | 222530-33-8.mol |  |
| | cis-3-(Boc-amino)cyclohexanecarboxylic acid Chemical Properties |
| Melting point | 143-147℃ | | Boiling point | 396.7±31.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.62±0.10(Predicted) | | color | White to Almost white | | Major Application | peptide synthesis | | InChI | InChI=1/C12H21NO4/c1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15/h8-9H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9+/s3 | | InChIKey | JSGHMGKJNZTKGF-MASDURLHNA-N | | SMILES | [C@@H]1(C(O)=O)CCC[C@H](NC(OC(C)(C)C)=O)C1 |&1:0,7,r| |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | cis-3-(Boc-amino)cyclohexanecarboxylic acid Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | Application | Cis-3-(Boc-amino)cyclohexanecarboxylic acid is mainly used for solid phase synthesis of peptides and is an important non-natural amino acid derivative. It can be used to synthesize certain drug intermediates, especially when it is necessary to introduce a protected amino group. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | cis-3-(Boc-amino)cyclohexanecarboxylic acid Preparation Products And Raw materials |
|