|
|
| | humantenine Basic information |
| Product Name: | humantenine | | Synonyms: | humantenine;Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-1-methoxy-1'-methyl-, (3S,3'Z,4'R,4'aS,7'R,9'aS)- | | CAS: | 82375-29-9 | | MF: | C21H26N2O3 | | MW: | 354.44 | | EINECS: | | | Product Categories: | Alkaloids | | Mol File: | 82375-29-9.mol |  |
| | humantenine Chemical Properties |
| Boiling point | 480.1±55.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 8.22±0.20(Predicted) | | form | Powder | | InChIKey | SJKRPUOXUNOPOP-YDAOCWKESA-N | | SMILES | N1(OC)C2=C(C=CC=C2)[C@@]2([C@@]3([H])C[C@@]4([H])/C(=C/C)/CN(C)[C@@]([H])(C2)[C@@]4([H])CO3)C1=O |
| | humantenine Usage And Synthesis |
| Uses | Humantenine is a indole alkaloid compound isolated from Gelsemium elegans[1]. | | References | [1] You-Kai Xu, et al. Koumine, Humantenine, and Yohimbane Alkaloids From Gelsemium Elegans. J Nat Prod. 2015 Jul 24;78(7):1511-7. DOI:10.1021/np5009619 |
| | humantenine Preparation Products And Raw materials |
|