|
|
| | Cyclopentylpropionyl chloride Basic information |
| | Cyclopentylpropionyl chloride Chemical Properties |
| Boiling point | 199-200 °C(lit.) | | density | 1.049 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.464(lit.) | | Fp | 184 °F | | form | liquid | | Sensitive | Moisture Sensitive | | BRN | 1856952 | | InChI | InChI=1S/C8H13ClO/c9-8(10)6-5-7-3-1-2-4-7/h7H,1-6H2 | | InChIKey | SZQVEGOXJYTLLB-UHFFFAOYSA-N | | SMILES | C1(CCC(Cl)=O)CCCC1 | | CAS DataBase Reference | 104-97-2(CAS DataBase Reference) | | NIST Chemistry Reference | Cyclopentylpropionyl chloride(104-97-2) |
| Hazard Codes | C | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2914790090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Cyclopentylpropionyl chloride Usage And Synthesis |
| Uses | 3-Cyclopentylpropionyl Chloride is an synthetic intermediate in the synthesis of new family of type 3 17β-Hydroxysteroid dehydrogenase inhibitors. | | Uses | Cyclopentanepropionyl chloride was used in the synthesis of 3-cyclopentylpropanamido)methylboronic acid. |
| | Cyclopentylpropionyl chloride Preparation Products And Raw materials |
|