|
|
| | 3,5,6,7,8,3',4'-Heptamethoxyflavone Basic information |
| Product Name: | 3,5,6,7,8,3',4'-Heptamethoxyflavone | | Synonyms: | 3,5,6,7,8,3',4'-hepteMthoxyflavone;5,6,7,8,3,4-hepteMthoxyflavone;2-(3,4-Dimethoxyphenyl)-3,5,6,7,8-pentamethoxy-4H-chromen-4-one;3-Methoxynobiletin;NSC 618928;3',4',3,5,6,7,8-Heptamethoxyflavone;4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-3,5,6,7,8-pentamethoxy-;inhibit,Inhibitor,3,?5,?6,?7,?8,?3',?4'-?Heptemthoxyflavone,3,?5,?6,?7,?8,?3',?4' ?Heptemthoxyflavone,3,?5,?6,?7,?8,?3',?4'?Heptemthoxyflavone | | CAS: | 1178-24-1 | | MF: | C22H24O9 | | MW: | 432.42 | | EINECS: | | | Product Categories: | | | Mol File: | 1178-24-1.mol |  |
| | 3,5,6,7,8,3',4'-Heptamethoxyflavone Chemical Properties |
| Melting point | 129-131 °C | | Boiling point | 618.7±55.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | solubility | DMSO: soluble; Methanol: soluble | | form | A solid | | color | White to off-white | | InChI | InChI=1S/C22H24O9/c1-24-12-9-8-11(10-13(12)25-2)16-19(27-4)15(23)14-17(26-3)20(28-5)22(30-7)21(29-6)18(14)31-16/h8-10H,1-7H3 | | InChIKey | SSXJHQZOHUYEGD-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(OC)C(OC)=C2)OC2=C(OC)C(OC)=C(OC)C(OC)=C2C(=O)C=1OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3,5,6,7,8,3',4'-Heptamethoxyflavone Usage And Synthesis |
| Chemical Properties | Light yellow powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Citrus aurantium. | | Uses | Used for content determination/identification/pharmacological experiments, etc. | | Definition | ChEBI: 3-Methoxynobiletin is a member of flavonoids and an ether. | | Biological Activity | 3,5,6,7,8,3',4'-Heptemthoxyflavone is a flavonoid in mandarin orange peel with anti-tumor initiating and anti-neuroinflammatory activities. 3,5,6,7,8,3',4'-Heptemthoxyflavone inhibits collagenase activity and increases the content of type I procollagen in human dermal fibroblast neonatal (HDFn) cells. 3,5,6,7,8,3',4'-Heptemthoxyflavone induces brain-derived neurotrophic factor (BDNF) expression via cAMP/ERK/CREB signaling and reduces phosphodiesterase activity in C6 cells. |
| | 3,5,6,7,8,3',4'-Heptamethoxyflavone Preparation Products And Raw materials |
|