| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | alpha-hydroxyetizolam Basic information |
| Product Name: | alpha-hydroxyetizolam | | Synonyms: | alpha-hydroxyetizolam;4-(2-Chlorophenyl)-α,9-dimethyl-6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-2-methanol;YRJXUAYHZCDGDO-UHFFFAOYSA-N;6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-2-methanol, 4-(2-chlorophenyl)-α,9-dimethyl-;Etizolam Impurity 1;α-hydroxy Etizolam;α-Hydroxyetizolam solution | | CAS: | 64546-10-7 | | MF: | C17H15ClN4OS | | MW: | 358.85 | | EINECS: | | | Product Categories: | | | Mol File: | 64546-10-7.mol |  |
| | alpha-hydroxyetizolam Chemical Properties |
| Boiling point | 595.3±60.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 15 mg/mL; DMSO: 15 mg/mL; Ethanol: 15 mg/mL; PBS (pH 7.2): 0.5 mg/mL | | form | A solid | | pka | 13.52±0.20(Predicted) | | Major Application | clinical testing | | InChI | 1S/C17H15ClN4OS/c1-9(23)14-7-11-8-19-15(12-5-3-4-6-13(12)18)16-21-20-10(2)22(16)17(11)24-14/h3-9,15,23H,1-2H3 | | InChIKey | BTGCWXDWJAGZML-UHFFFAOYSA-N | | SMILES | [s]1c2c(cc1C(O)C)C=NC(c4[n]2c(nn4)C)c3c(cccc3)Cl |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | alpha-hydroxyetizolam Usage And Synthesis |
| Uses | alpha-hydroxyetizolam is a metabolite of Brotizolam (B689280). A hypnotic and a sedative, also used in veterinary medicine as an appetite stimulant. |
| | alpha-hydroxyetizolam Preparation Products And Raw materials |
|