| Company Name: |
AdooQ BioScience, LLC
|
| Tel: |
+1 (866) 930-6790 |
| Email: |
info@adooq.com |
| Products Intro: |
Product Name:Dihydroeponemycin
CAS:126463-64-7
Purity:98% Package:5mg;10mg;25mg;50mg;100mg;250mg;500mg;1g
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Dihydroeponemycin
CAS:126463-64-7
Purity:98% Package:1G;10G;100G Remarks:Dihydroeponemycin is a natural, irreversible inhibitor of proteasomal degradation of proteins that acts by binding the IFN-γ-inducible proteins LMP2 and LMP7, as well as the constitutive proteasome su
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Dihydroeponemycin >=98% (HPLC)
CAS:126463-64-7
Purity:98% (HPLC) Package:1mg;5mg Remarks:NULL
|
| Company Name: |
MedBioPharmaceutical Technology Inc
|
| Tel: |
021-69568360 18916172912 |
| Email: |
order@med-bio.cn |
| Products Intro: |
Product Name:dihydroeponemycin
CAS:126463-64-7
Purity:98% Package:25mg; 10mM (in 1mL DMSO); 5mg; 1mg Remarks:Medbio
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Dihydroeponemycin
CAS:126463-64-7
|
|
| | dihydroeponemycin Basic information |
| Product Name: | dihydroeponemycin | | Synonyms: | dihydroeponemycin;Heptanamide, N-[(1S)-1-(hydroxymethyl)-2-[[(1S)-1-[[(2R)-2-(hydroxymethyl)-2-oxiranyl]carbonyl]-3-methylbutyl]amino]-2-oxoethyl]-6-methyl-;Dihydroeponemycin >=98% (HPLC) | | CAS: | 126463-64-7 | | MF: | C20H36N2O6 | | MW: | 400.51 | | EINECS: | | | Product Categories: | | | Mol File: | 126463-64-7.mol |  |
| | dihydroeponemycin Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: ≥1mg/mL | | form | powder | | color | off-white to light tan | | Optical Rotation | [α]/D ±35.7° | | InChI | 1S/C20H36N2O6/c1-13(2)7-5-6-8-17(25)21-16(10-23)19(27)22-15(9-14(3)4)18(26)20(11-24)12-28-20/h13-16,23-24H,5-12H2,1-4H3,(H,21,25)(H,22,27)/t15-,16-,20+/m0/s1 | | InChIKey | IUDBVFIQSSOIDB-TWOQFEAHSA-N | | SMILES | CC(C)CCCCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(CO)CO1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | dihydroeponemycin Usage And Synthesis |
| Description | Dihydroeponemycin is a natural, irreversible inhibitor of proteasomal degradation of proteins that acts by binding the IFN-γ-inducible proteins LMP2 and LMP7, as well as the constitutive proteasome subunit X. It potently inhibits both the chymotrypsin-like and PGPH activity, with 10-fold less inhibition of trypsin-like activity. Dihydroeponemycin does not inhibit calpain or trypsin and has minor effects on cathepsin B and chymotrypsin at higher concentrations. It is cell-permeable and induces apoptosis in bovine aortic endothelial cells. | | Uses | Dihydroeponemycin, an analogue of the antitumor and antiangiogenic natural product eponemycin, selectively targets the 20S proteasome. Dihydroeponemycin covalently modifies a subset of catalytic proteasomal subunits, binding preferentially to the IFN-gamma-inducible subunits LMP2 and LMP7. Dihydroeponemycin-mediated proteasome inhibition induces a spindle-like cellular morphological change and apoptosis[1]. | | target | Proteasome | | References | [1] Meng L, et al. Eponemycin exerts its antitumor effect through the inhibition of proteasome function. Cancer Res. 1999;59(12):2798-2801. PMID:10383134 |
| | dihydroeponemycin Preparation Products And Raw materials |
|