| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 11-hydroxycannabinol Basic information |
| Product Name: | 11-hydroxycannabinol | | Synonyms: | 11-hydroxycannabinol;6H-Dibenzo[b,d]pyran-9-methanol, 1-hydroxy-6,6-dimethyl-3-pentyl-;11-Hydroxy cannabinol (11-OH-CBN) solution | | CAS: | 30432-08-7 | | MF: | C21H26O3 | | MW: | 326.43 | | EINECS: | | | Product Categories: | | | Mol File: | 30432-08-7.mol |  |
| | 11-hydroxycannabinol Chemical Properties |
| Boiling point | 525.5±50.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | storage temp. | -10 to -25°C | | solubility | DMF: 12 mg/mL; DMSO: 10 mg/mL; Ethanol: Slightly soluble; PBS (pH 7.2): 0.25 mg/mL | | form | A solid | | pka | 9.31±0.40(Predicted) | | InChIKey | YDKZOUNVEIGJPO-UHFFFAOYSA-N | | SMILES | CCCCCC1=CC2=C(C3=CC(CO)=CC=C3C(C)(C)O2)C(O)=C1 |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | 11-hydroxycannabinol Usage And Synthesis |
| Uses | 11-Hydroxy cannabinol (Compound 5b) is an active metabolite of Cannabinol[1][2]. | | References | [1] Consroe P, et al. Use of a potential rabbit model for structure--behavioral activity studies of cannabinoids. J Med Chem. 1982 May;25(5):596-9. DOI:10.1021/jm00347a021
[2] Yamamoto I, et al. The pharmacological activity of cannabinol and its major metabolite, 11-hydroxycannabinol. Chem Pharm Bull (Tokyo). 1987 May;35(5):2144-7. DOI:10.1248/cpb.35.2144 |
| | 11-hydroxycannabinol Preparation Products And Raw materials |
|