|
|
| | Methyl 4-fluorobenzoate Basic information |
| | Methyl 4-fluorobenzoate Chemical Properties |
| Melting point | 4.5 °C | | Boiling point | 90-92 °C/20 mmHg (lit.) | | density | 1.192 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.494(lit.) | | Fp | 172 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | Specific Gravity | 1.201.192 | | color | Clear Colourless | | BRN | 2085925 | | InChI | InChI=1S/C8H7FO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5H,1H3 | | InChIKey | MSEBQGULDWDIRW-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(F)C=C1 | | CAS DataBase Reference | 403-33-8(CAS DataBase Reference) | | NIST Chemistry Reference | 4-F-C6H4-COOCH3(403-33-8) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 22-37/38-41-36/38 | | Safety Statements | 26-36/39-36 | | RIDADR | NA1993 | | WGK Germany | 2 | | Hazard Note | Toxic | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | Methyl 4-fluorobenzoate Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 4-Fluorobenzoic Acid Methyl Ester, is an organic fluorinated building block used for the synthesis of various pharmaceutical compounds. It can be used for the preparation of Blonanserin (B595850). | | Uses | Methyl 4-fluorobenzoate can be used in the synthesis of trisubstituted imidazole derivatives containing a 4-fluorophenyl group, a pyrimidine ring, and a CN- or CONH2-substituted benzyl moiety. |
| | Methyl 4-fluorobenzoate Preparation Products And Raw materials |
|