N,N-Dimethylformamide dipropyl acetal manufacturers
|
| | N,N-Dimethylformamide dipropyl acetal Basic information |
| Product Name: | N,N-Dimethylformamide dipropyl acetal | | Synonyms: | 1,1-Dipropoxy-N,N-dimethylmethylamine;N,N-Dimethylformamide Dipropyl Acetal [for Esterification];N,N-Dimethylforamide di-n-propyl acetal (for esterification);N,N-DIMETHYLFORMAMIDE DIPROPYL ACETAL, D ERIVATIZATION GRADE;N,N-DIMETHYLFORMAMIDE DIPROPYL ACETAL, 9 7%;1,1-Dipropoxy-N,N-dimethylmethylamine, 1,1-Dipropoxytrimethylamine;N,N-Dimethylformamide dipropyl acetal,1,1-Dipropoxy-N,N-dimethylmethylamine, 1,1-Dipropoxytrimethylamine;N,N-DiMethylforMaMide dipropyl acetal, 98% 5GR | | CAS: | 6006-65-1 | | MF: | C9H21NO2 | | MW: | 175.27 | | EINECS: | 227-855-4 | | Product Categories: | Acetals/Ketals/Ortho Esters;Building Blocks;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Analytical Chemistry;Esterification & Alkylation (GC Derivatizing Reagents);GC Derivatizing Reagents;N,N-Dimethylformamide Dialkylacetals (GC Derivatizing Reagents) | | Mol File: | 6006-65-1.mol |  |
| | N,N-Dimethylformamide dipropyl acetal Chemical Properties |
| Boiling point | 67-68 °C/14 mmHg (lit.) | | density | 0.854 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.409(lit.) | | Fp | 100 °F | | storage temp. | Flammables area | | pka | 5.25±0.50(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | It hydrolyzes with water. | | Sensitive | Moisture Sensitive | | BRN | 1098524 | | InChI | InChI=1S/C9H21NO2/c1-5-7-11-9(10(3)4)12-8-6-2/h9H,5-8H2,1-4H3 | | InChIKey | NSLGQFIDCADTAS-UHFFFAOYSA-N | | SMILES | C(OCCC)(OCCC)N(C)C | | CAS DataBase Reference | 6006-65-1(CAS DataBase Reference) | | NIST Chemistry Reference | N,N-Dimethylformamide dipropyl acetal(6006-65-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29225000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | N,N-Dimethylformamide dipropyl acetal Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | N,N-Dimethylformamide di-n-propyl acetal, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. | | Uses | It was used as derivatizing agent in a study to determine cocaine and benzoyl ecgonine in urine using GC with on-column alkylation. | | General Description | N,N-Dimethylformamide dipropyl acetal is an derivatizing reagent. | | reaction suitability | reagent type: derivatization reagent reaction type: Acylations |
| | N,N-Dimethylformamide dipropyl acetal Preparation Products And Raw materials |
|