- Cynaropicrin
-
- $56.00 / 1mg
-
2026-01-30
- CAS:35730-78-0
- Min. Order:
- Purity: 98.47%
- Supply Ability: 10g
- cynaropicrin
-
- $1.00 / 1kg
-
2019-07-06
- CAS:35730-78-0
- Min. Order: 1 mg
- Purity: 99%
- Supply Ability: 100KG
|
| | cynaropicrin Basic information |
| Product Name: | cynaropicrin | | Synonyms: | 2-Hydroxymethylpropenoic acid (3aR,4S,6aβ,9aβ,9bα)-dodecahydro-8α-hydroxy-3,6,9-tris(methylene)-2-oxoazuleno[4,5-b]furan-4-yl ester;Cynaropikrin;[(3aR,4S,6aR,8S,9aR,9bR)-8-hydroxy-3,6,9-trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] 2-(hydroxymethyl)prop-2-enoate;2-methylolacrylic acid [(3aR,4S,6aR,8S,9aR,9bR)-8-hydroxy-2-keto-3,6,9-trimethylene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] ester;CYNAROPICRIN(SH);cynaropicrin;Cynaropicrin - Cynara cardunculus (artichoke);2-Propenoic acid, 2-(hydroxymethyl)-, (3aR,4S,6aR,8S,9aR,9bR)-dodecahydro-8-hydroxy-3,6,9-tris(methylene)-2-oxoazuleno[4,5-b]furan-4-yl ester | | CAS: | 35730-78-0 | | MF: | C19H22O6 | | MW: | 346.37 | | EINECS: | | | Product Categories: | | | Mol File: | 35730-78-0.mol |  |
| | cynaropicrin Chemical Properties |
| Boiling point | 566.2±50.0 °C(Predicted) | | density | 1.28±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | -20°C, protect from light | | solubility | DMSO:50.0(Max Conc. mg/mL);144.35(Max Conc. mM) | | pka | 13.52±0.10(Predicted) | | form | Oil | | color | Off-white to light yellow | | biological source | plant | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h12-17,20-21H,1-7H2/t12-,13-,14-,15-,16+,17+/m0/s1 | | InChIKey | KHSCYOFDKADJDJ-NQLMQOPMSA-N | | SMILES | O1[C@@H]2[C@@H]3[C@@H](C[C@@H](C3=C)O)C(=C)C[C@@H]([C@H]2C(=C)C1=O)OC(=O)C(=C)CO | | LogP | 1.340 (est) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | cynaropicrin Usage And Synthesis |
| Uses | Cynaropicrin can inhibit lipopolysaccharide-induced TNF-α release from either murine or human macrophage cells in a dose-dependent manner with the IC50 values of 8.24 and 3.18 μM, respectively. It can also inhibit the increase of cartilage degradation factor (MMP13) and suppresses NF-κB signaling. | | Definition | ChEBI: Cynaropicrin is a sesquiterpene lactone. | | Biological Activity | Cynaropicrin is a potent activator of the AhR-Nrf2-Nqo1 pathway, making it a potential candidate for preventing UVB-induced photoaging. Additionally, it exhibits pro-apoptotic activity, suggesting its potential as an anticancer agent against certain leukocyte cancer cells such as lymphoma or leukemia. Cynaropicrin has demonstrated in vivo activity against Trypanosoma brucei and exhibits immunomodulatory effects by influencing cytokine release and nitric oxide production while also displaying immunosuppressive properties. Moreover, it has anti-inflammatory effects by inhibiting the production of inflammatory mediators and lymphocyte proliferation, which is achieved through conjugation with sulphydryl groups of target protein(s). |
| | cynaropicrin Preparation Products And Raw materials |
|